C22H21NO3 — CID 18568668
N-(4-oxo-2-phenylchromen-6-yl)cyclohexanecarboxamide (PubChem CID 18568668) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is N-(4-oxo-2-phenylchromen-6-yl)cyclohexanecarboxamide.
| Compound Name | N-(4-oxo-2-phenylchromen-6-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 18568668 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-(4-oxo-2-phenylchromen-6-yl)cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccc2oc(-c3ccccc3)cc(=O)c2c1)C1CCCCC1 |
| InChI | InChI=1S/C22H21NO3/c24-19-14-21(15-7-3-1-4-8-15)26-20-12-11-17(13-18(19)20)23-22(25)16-9-5-2-6-10-16/h1,3-4,7-8,11-14,16H,2,5-6,9-10H2,(H,23,25) |
| InChIKey | ZHPWDEJALFGZQF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |