C23H23NO3 — CID 18568688
N-[2-(3-methylphenyl)-4-oxochromen-6-yl]cyclohexanecarboxamide (PubChem CID 18568688) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[2-(3-methylphenyl)-4-oxochromen-6-yl]cyclohexanecarboxamide.
| Compound Name | N-[2-(3-methylphenyl)-4-oxochromen-6-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 18568688 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-[2-(3-methylphenyl)-4-oxochromen-6-yl]cyclohexanecarboxamide |
| SMILES | Cc1cccc(-c2cc(=O)c3cc(NC(=O)C4CCCCC4)ccc3o2)c1 |
| InChI | InChI=1S/C23H23NO3/c1-15-6-5-9-17(12-15)22-14-20(25)19-13-18(10-11-21(19)27-22)24-23(26)16-7-3-2-4-8-16/h5-6,9-14,16H,2-4,7-8H2,1H3,(H,24,26) |
| InChIKey | IDCUHOUEIITRIO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |