C10H20ClNO3S — CID 18590534
4-(cyclohexylamino)-1,1-dioxothiolan-3-ol;hydrochloride (PubChem CID 18590534) has the molecular formula C10H20ClNO3S and a molecular weight of 269.79 g/mol. Its IUPAC name is 4-(cyclohexylamino)-1,1-dioxothiolan-3-ol;hydrochloride.
| Compound Name | 4-(cyclohexylamino)-1,1-dioxothiolan-3-ol;hydrochloride |
|---|---|
| PubChem CID | 18590534 |
| Molecular Formula | C10H20ClNO3S |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-(cyclohexylamino)-1,1-dioxothiolan-3-ol;hydrochloride |
| SMILES | Cl.O=S1(=O)CC(O)C(NC2CCCCC2)C1 |
| InChI | InChI=1S/C10H19NO3S.ClH/c12-10-7-15(13,14)6-9(10)11-8-4-2-1-3-5-8;/h8-12H,1-7H2;1H |
| InChIKey | JWXUZERUZVIWEO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |