C22H28Cl2N2O4S — CID 18590556
[6-hexyl-3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-7-yl] 2-aminopropanoate;dihydrochloride (PubChem CID 18590556) has the molecular formula C22H28Cl2N2O4S and a molecular weight of 487.45 g/mol. Its IUPAC name is [6-hexyl-3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-7-yl] 2-aminopropanoate;dihydrochloride.
| Compound Name | [6-hexyl-3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-7-yl] 2-aminopropanoate;dihydrochloride |
|---|---|
| PubChem CID | 18590556 |
| Molecular Formula | C22H28Cl2N2O4S |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | [6-hexyl-3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-7-yl] 2-aminopropanoate;dihydrochloride |
| SMILES | CCCCCCc1cc2c(=O)c(-c3nc(C)cs3)coc2cc1OC(=O)C(C)N.Cl.Cl |
| InChI | InChI=1S/C22H26N2O4S.2ClH/c1-4-5-6-7-8-15-9-16-19(10-18(15)28-22(26)14(3)23)27-11-17(20(16)25)21-24-13(2)12-29-21;;/h9-12,14H,4-8,23H2,1-3H3;2*1H |
| InChIKey | ATYFVSOGKJKKCN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|