C19H19N2O4+ — CID 6954988
[2-oxo-2-(4-oxo-6-propyl-3-pyridin-2-ylchromen-7-yl)oxyethyl]azanium (PubChem CID 6954988) has the molecular formula C19H19N2O4+ and a molecular weight of 339.37 g/mol. Its IUPAC name is [2-oxo-2-(4-oxo-6-propyl-3-pyridin-2-ylchromen-7-yl)oxyethyl]azanium.
| Compound Name | [2-oxo-2-(4-oxo-6-propyl-3-pyridin-2-ylchromen-7-yl)oxyethyl]azanium |
|---|---|
| PubChem CID | 6954988 |
| Molecular Formula | C19H19N2O4+ |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | [2-oxo-2-(4-oxo-6-propyl-3-pyridin-2-ylchromen-7-yl)oxyethyl]azanium |
| SMILES | CCCc1cc2c(=O)c(-c3ccccn3)coc2cc1OC(=O)C[NH3+] |
| InChI | InChI=1S/C19H18N2O4/c1-2-5-12-8-13-17(9-16(12)25-18(22)10-20)24-11-14(19(13)23)15-6-3-4-7-21-15/h3-4,6-9,11H,2,5,10,20H2,1H3/p+1 |
| InChIKey | DBJMDBORZIMDNJ-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|