C30H28N2O4 — CID 100931668
[6-hexyl-3-(1-methylbenzimidazol-2-yl)-4-oxochromen-7-yl] benzoate (PubChem CID 100931668) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is [6-hexyl-3-(1-methylbenzimidazol-2-yl)-4-oxochromen-7-yl] benzoate.
| Compound Name | [6-hexyl-3-(1-methylbenzimidazol-2-yl)-4-oxochromen-7-yl] benzoate |
|---|---|
| PubChem CID | 100931668 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | [6-hexyl-3-(1-methylbenzimidazol-2-yl)-4-oxochromen-7-yl] benzoate |
| SMILES | CCCCCCc1cc2c(=O)c(-c3nc4ccccc4n3C)coc2cc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H28N2O4/c1-3-4-5-7-14-21-17-22-27(18-26(21)36-30(34)20-12-8-6-9-13-20)35-19-23(28(22)33)29-31-24-15-10-11-16-25(24)32(29)2/h6,8-13,15-19H,3-5,7,14H2,1-2H3 |
| InChIKey | JRXHNCYHCOHRKW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|