C27H28N4O6 — CID 4850891
6-[[2-[6-ethyl-4-oxo-3-(4-phenyl-1,2,4-triazol-3-yl)chromen-7-yl]oxyacetyl]amino]hexanoic acid (PubChem CID 4850891) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is 6-[[2-[6-ethyl-4-oxo-3-(4-phenyl-1,2,4-triazol-3-yl)chromen-7-yl]oxyacetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[6-ethyl-4-oxo-3-(4-phenyl-1,2,4-triazol-3-yl)chromen-7-yl]oxyacetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 4850891 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 6-[[2-[6-ethyl-4-oxo-3-(4-phenyl-1,2,4-triazol-3-yl)chromen-7-yl]oxyacetyl]amino]hexanoic acid |
| SMILES | CCc1cc2c(=O)c(-c3nncn3-c3ccccc3)coc2cc1OCC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C27H28N4O6/c1-2-18-13-20-23(14-22(18)37-16-24(32)28-12-8-4-7-11-25(33)34)36-15-21(26(20)35)27-30-29-17-31(27)19-9-5-3-6-10-19/h3,5-6,9-10,13-15,17H,2,4,7-8,11-12,16H2,1H3,(H,28,32)(H,33,34) |
| InChIKey | VZQKAUIXONPGSL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|