C24H34O2 — CID 18597454
(5R,6S,8R,9S,10S,13S,14S,17R)-17-acetyl-17-ethynyl-6,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 18597454) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (5R,6S,8R,9S,10S,13S,14S,17R)-17-acetyl-17-ethynyl-6,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,6S,8R,9S,10S,13S,14S,17R)-17-acetyl-17-ethynyl-6,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 18597454 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (5R,6S,8R,9S,10S,13S,14S,17R)-17-acetyl-17-ethynyl-6,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C#C[C@]1(C(C)=O)CC[C@H]2[C@@H]3C[C@H](C)[C@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H34O2/c1-6-24(16(3)25)12-9-20-18-13-15(2)21-14-17(26)7-10-22(21,4)19(18)8-11-23(20,24)5/h1,15,18-21H,7-14H2,2-5H3/t15-,18+,19-,20-,21+,22+,23-,24+/m0/s1 |
| InChIKey | REDZZOWOHMTSLA-OMNGNXQGSA-N |
| XLogP | 5.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|