C23H36O4 — CID 67731703
(6S,8S,9S,10S,13S,14S,17S)-17-acetyl-1,1-dihydroxy-6,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67731703) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is (6S,8S,9S,10S,13S,14S,17S)-17-acetyl-1,1-dihydroxy-6,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9S,10S,13S,14S,17S)-17-acetyl-1,1-dihydroxy-6,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67731703 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (6S,8S,9S,10S,13S,14S,17S)-17-acetyl-1,1-dihydroxy-6,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@@]1(C)CC[C@H]2[C@@H]3C[C@H](C)C4CC(=O)CC(O)(O)[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H36O4/c1-13-10-16-17-6-8-20(3,14(2)24)21(17,4)9-7-18(16)22(5)19(13)11-15(25)12-23(22,26)27/h13,16-19,26-27H,6-12H2,1-5H3/t13-,16-,17-,18-,19?,20+,21-,22+/m0/s1 |
| InChIKey | FWAZJGHOKWPKDH-GQDPFPQXSA-N |
| XLogP | 3.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|