C28H38O5 — CID 163628696
(1R,5S,6S)-6-acetyl-1,5,6,12-tetramethyl-16-oxahexacyclo[10.10.1.02,10.05,9.014,18.019,23]tricosane-15,17,20-trione (PubChem CID 163628696) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is (1R,5S,6S)-6-acetyl-1,5,6,12-tetramethyl-16-oxahexacyclo[10.10.1.02,10.05,9.014,18.019,23]tricosane-15,17,20-trione.
| Compound Name | (1R,5S,6S)-6-acetyl-1,5,6,12-tetramethyl-16-oxahexacyclo[10.10.1.02,10.05,9.014,18.019,23]tricosane-15,17,20-trione |
|---|---|
| PubChem CID | 163628696 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (1R,5S,6S)-6-acetyl-1,5,6,12-tetramethyl-16-oxahexacyclo[10.10.1.02,10.05,9.014,18.019,23]tricosane-15,17,20-trione |
| SMILES | CC(=O)[C@@]1(C)CCC2C3CC4(C)CC5C(=O)OC(=O)C5C5C(=O)CC[C@](C)(C3CC[C@@]21C)C54 |
| InChI | InChI=1S/C28H38O5/c1-14(29)27(4)10-7-18-15-12-25(2)13-16-20(24(32)33-23(16)31)21-19(30)8-9-26(3,22(21)25)17(15)6-11-28(18,27)5/h15-18,20-22H,6-13H2,1-5H3/t15?,16?,17?,18?,20?,21?,22?,25?,26-,27-,28+/m1/s1 |
| InChIKey | HUEVVUOUQSMHHK-HBOPXQRYSA-N |
| XLogP | 4.76 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|