C23H32Br2O4 — CID 154395127
[(8S,9S,10R,11R,13S,14S,17R)-17-acetyl-4,17-dibromo-10,13-dimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate (PubChem CID 154395127) has the molecular formula C23H32Br2O4 and a molecular weight of 532.31 g/mol. Its IUPAC name is [(8S,9S,10R,11R,13S,14S,17R)-17-acetyl-4,17-dibromo-10,13-dimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate.
| Compound Name | [(8S,9S,10R,11R,13S,14S,17R)-17-acetyl-4,17-dibromo-10,13-dimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
|---|---|
| PubChem CID | 154395127 |
| Molecular Formula | C23H32Br2O4 |
| Molecular Weight | 532.31 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | [(8S,9S,10R,11R,13S,14S,17R)-17-acetyl-4,17-dibromo-10,13-dimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(C)[C@@H](CC[C@]2(Br)C(C)=O)[C@@H]2CCC3C(Br)C(=O)CC[C@]3(C)[C@H]21 |
| InChI | InChI=1S/C23H32Br2O4/c1-12(26)23(25)10-7-15-14-5-6-16-20(24)17(28)8-9-21(16,3)19(14)18(29-13(2)27)11-22(15,23)4/h14-16,18-20H,5-11H2,1-4H3/t14-,15-,16?,18+,19+,20?,21-,22-,23-/m0/s1 |
| InChIKey | LLUDYVMBVXVHTF-KFQRCZMDSA-N |
| XLogP | 5.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.31 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|