C17H26O4 — CID 18599621
cis-(1R,3S)-3-(3-butoxy-3-oxoprop-1-ynyl)-1-tert-butyl-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 18599621) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is cis-(1R,3S)-3-(3-butoxy-3-oxoprop-1-ynyl)-1-tert-butyl-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(3-butoxy-3-oxoprop-1-ynyl)-1-tert-butyl-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 18599621 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | cis-(1R,3S)-3-(3-butoxy-3-oxoprop-1-ynyl)-1-tert-butyl-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CCCCOC(=O)C#C[C@H]1C(C)(C)[C@]1(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C17H26O4/c1-7-8-11-21-13(18)10-9-12-16(5,6)17(12,14(19)20)15(2,3)4/h12H,7-8,11H2,1-6H3,(H,19,20)/t12-,17+/m0/s1 |
| InChIKey | LGXSYZQAPVUQKH-YVEFUNNKSA-N |
| XLogP | 3.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|