C16H24O4 — CID 57093538
trans-tert-butyl (1R,3S)-2,2-dimethyl-3-(3-oxo-3-propoxyprop-1-ynyl)cyclopropane-1-carboxylate (PubChem CID 57093538) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is trans-tert-butyl (1R,3S)-2,2-dimethyl-3-(3-oxo-3-propoxyprop-1-ynyl)cyclopropane-1-carboxylate.
| Compound Name | trans-tert-butyl (1R,3S)-2,2-dimethyl-3-(3-oxo-3-propoxyprop-1-ynyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57093538 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | trans-tert-butyl (1R,3S)-2,2-dimethyl-3-(3-oxo-3-propoxyprop-1-ynyl)cyclopropane-1-carboxylate |
| SMILES | CCCOC(=O)C#C[C@H]1[C@@H](C(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C16H24O4/c1-7-10-19-12(17)9-8-11-13(16(11,5)6)14(18)20-15(2,3)4/h11,13H,7,10H2,1-6H3/t11-,13-/m0/s1 |
| InChIKey | SHPBHFNYPRAGJX-AAEUAGOBSA-N |
| XLogP | 2.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|