C24H27NO3 — CID 18610696
9H-fluoren-9-ylmethyl (2S)-2-(1-hydroxypent-4-enyl)pyrrolidine-1-carboxylate (PubChem CID 18610696) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S)-2-(1-hydroxypent-4-enyl)pyrrolidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2S)-2-(1-hydroxypent-4-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18610696 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S)-2-(1-hydroxypent-4-enyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCCC(O)[C@@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H27NO3/c1-2-3-14-23(26)22-13-8-15-25(22)24(27)28-16-21-19-11-6-4-9-17(19)18-10-5-7-12-20(18)21/h2,4-7,9-12,21-23,26H,1,3,8,13-16H2/t22-,23?/m0/s1 |
| InChIKey | MXSWJWYMVHGNKO-NQCNTLBGSA-N |
| XLogP | 4.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|