C12H23ClN2O4 — CID 18610964
ethyl (7aS)-6-acetyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate;hydrate;hydrochloride (PubChem CID 18610964) has the molecular formula C12H23ClN2O4 and a molecular weight of 294.78 g/mol. Its IUPAC name is ethyl (7aS)-6-acetyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate;hydrate;hydrochloride.
| Compound Name | ethyl (7aS)-6-acetyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate;hydrate;hydrochloride |
|---|---|
| PubChem CID | 18610964 |
| Molecular Formula | C12H23ClN2O4 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | ethyl (7aS)-6-acetyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate;hydrate;hydrochloride |
| SMILES | CCOC(=O)N1CCC2CCN(C(C)=O)C[C@H]21.Cl.O |
| InChI | InChI=1S/C12H20N2O3.ClH.H2O/c1-3-17-12(16)14-7-5-10-4-6-13(9(2)15)8-11(10)14;;/h10-11H,3-8H2,1-2H3;1H;1H2/t10?,11-;;/m1../s1 |
| InChIKey | HCSRVTQNXUZIFU-YIYGWLNYSA-N |
| XLogP | 0.68 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |