C20H32N4O2 — CID 174648166
ethyl 4-[4-(aminomethyl)phenyl]-2-(1-methylpiperidin-4-yl)piperazine-1-carboxylate (PubChem CID 174648166) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is ethyl 4-[4-(aminomethyl)phenyl]-2-(1-methylpiperidin-4-yl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(aminomethyl)phenyl]-2-(1-methylpiperidin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174648166 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | ethyl 4-[4-(aminomethyl)phenyl]-2-(1-methylpiperidin-4-yl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccc(CN)cc2)CC1C1CCN(C)CC1 |
| InChI | InChI=1S/C20H32N4O2/c1-3-26-20(25)24-13-12-23(18-6-4-16(14-21)5-7-18)15-19(24)17-8-10-22(2)11-9-17/h4-7,17,19H,3,8-15,21H2,1-2H3 |
| InChIKey | KNFHKLOUAXGJEJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|