C17H26N4O2 — CID 91350585
ethyl 2-piperidin-4-yl-4-pyridin-4-ylpiperazine-1-carboxylate (PubChem CID 91350585) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is ethyl 2-piperidin-4-yl-4-pyridin-4-ylpiperazine-1-carboxylate.
| Compound Name | ethyl 2-piperidin-4-yl-4-pyridin-4-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 91350585 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | ethyl 2-piperidin-4-yl-4-pyridin-4-ylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccncc2)CC1C1CCNCC1 |
| InChI | InChI=1S/C17H26N4O2/c1-2-23-17(22)21-12-11-20(15-5-9-19-10-6-15)13-16(21)14-3-7-18-8-4-14/h5-6,9-10,14,16,18H,2-4,7-8,11-13H2,1H3 |
| InChIKey | QBWBCMIZRAZDQM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |