About [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride
[1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride (PubChem CID 67706422) has the molecular formula C19H29ClN4O3
and a molecular weight of 396.92 g/mol. Its IUPAC name is [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride.
Molecular Properties
| Compound Name | [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride |
| PubChem CID | 67706422 |
| Molecular Formula | C19H29ClN4O3 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride |
| SMILES | CC(OC(=O)CC1CCNCC1)C(=O)N1CCN(c2ccncc2)CC1.Cl |
| InChI | InChI=1S/C19H28N4O3.ClH/c1-15(26-18(24)14-16-2-6-20-7-3-16)19(25)23-12-10-22(11-13-23)17-4-8-21-9-5-17;/h4-5,8-9,15-16,20H,2-3,6-7,10-14H2,1H3;1H |
| InChIKey | ZKNWOVGZSXQKLK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride?
The IUPAC name of [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride (CID 67706422) is [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride.
What is the SMILES notation for [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride?
The canonical SMILES for [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride is CC(OC(=O)CC1CCNCC1)C(=O)N1CCN(c2ccncc2)CC1.Cl.
What is the InChIKey of [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride?
The InChIKey is ZKNWOVGZSXQKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O3.ClH/c1-15(26-18(24)14-16-2-6-20-7-3-16)19(25)23-12-10-22(11-13-23)17-4-8-21-9-5-17;/h4-5,8-9,15-16,20H,2-3,6-7,10-14H2,1H3;1H.
What are the key properties of [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride?
[1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride has a molecular weight of 396.92 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-oxo-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl] 2-piperidin-4-ylacetate;hydrochloride is sourced from PubChem (CID 67706422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).