C19H28N4O3 — CID 67706408
(4-pyridin-4-ylpiperazin-1-yl) 3-oxo-2-piperidin-4-ylpentanoate (PubChem CID 67706408) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is (4-pyridin-4-ylpiperazin-1-yl) 3-oxo-2-piperidin-4-ylpentanoate.
| Compound Name | (4-pyridin-4-ylpiperazin-1-yl) 3-oxo-2-piperidin-4-ylpentanoate |
|---|---|
| PubChem CID | 67706408 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (4-pyridin-4-ylpiperazin-1-yl) 3-oxo-2-piperidin-4-ylpentanoate |
| SMILES | CCC(=O)C(C(=O)ON1CCN(c2ccncc2)CC1)C1CCNCC1 |
| InChI | InChI=1S/C19H28N4O3/c1-2-17(24)18(15-3-7-20-8-4-15)19(25)26-23-13-11-22(12-14-23)16-5-9-21-10-6-16/h5-6,9-10,15,18,20H,2-4,7-8,11-14H2,1H3 |
| InChIKey | OSDRNTURWWBBFY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|