C21H32N4O3 — CID 67706362
3-oxo-2-piperidin-4-yl-2-(4-pyridin-4-ylpiperazin-1-yl)heptanoic acid (PubChem CID 67706362) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-oxo-2-piperidin-4-yl-2-(4-pyridin-4-ylpiperazin-1-yl)heptanoic acid.
| Compound Name | 3-oxo-2-piperidin-4-yl-2-(4-pyridin-4-ylpiperazin-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 67706362 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 3-oxo-2-piperidin-4-yl-2-(4-pyridin-4-ylpiperazin-1-yl)heptanoic acid |
| SMILES | CCCCC(=O)C(C(=O)O)(C1CCNCC1)N1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C21H32N4O3/c1-2-3-4-19(26)21(20(27)28,17-5-9-22-10-6-17)25-15-13-24(14-16-25)18-7-11-23-12-8-18/h7-8,11-12,17,22H,2-6,9-10,13-16H2,1H3,(H,27,28) |
| InChIKey | WWUAVFOEOFODRO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|