C11H19NO3 — CID 82753440
2-hydroxyethyl 2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (PubChem CID 82753440) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-hydroxyethyl 2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate.
| Compound Name | 2-hydroxyethyl 2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 82753440 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2-hydroxyethyl 2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| SMILES | O=C(OCCO)N1CCC2CCCCC21 |
| InChI | InChI=1S/C11H19NO3/c13-7-8-15-11(14)12-6-5-9-3-1-2-4-10(9)12/h9-10,13H,1-8H2 |
| InChIKey | RIMRPHOLZKRRPM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |