About propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate
propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (PubChem CID 67173352) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate.
Analyze propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate?
The IUPAC name of propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (CID 67173352) is propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate.
What is the SMILES notation for propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate?
The canonical SMILES for propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate is CCCOC(=O)N1CCC2C(=O)CCCC21.
What is the InChIKey of propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate?
The InChIKey is OWYVAGKMUCQNFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3/c1-2-8-16-12(15)13-7-6-9-10(13)4-3-5-11(9)14/h9-10H,2-8H2,1H3.
What are the key properties of propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate?
propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate has a molecular weight of 225.29 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate is sourced from PubChem (CID 67173352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).