C9H6F3IN2O5 — CID 18613382
[4-iodo-2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamic acid (PubChem CID 18613382) has the molecular formula C9H6F3IN2O5 and a molecular weight of 406.05 g/mol. Its IUPAC name is [4-iodo-2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamic acid.
| Compound Name | [4-iodo-2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamic acid |
|---|---|
| PubChem CID | 18613382 |
| Molecular Formula | C9H6F3IN2O5 |
| Molecular Weight | 406.05 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | [4-iodo-2-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(OCC(F)(F)F)c(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H6F3IN2O5/c10-9(11,12)3-20-7-2-5(14-8(16)17)6(15(18)19)1-4(7)13/h1-2,14H,3H2,(H,16,17) |
| InChIKey | OJVLOZUJNFVXHM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.05 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|