C14H18FNO2S — CID 18613626
methyl 2-[3-(2,2-dimethylpropanethioylamino)-4-fluorophenyl]acetate (PubChem CID 18613626) has the molecular formula C14H18FNO2S and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl 2-[3-(2,2-dimethylpropanethioylamino)-4-fluorophenyl]acetate.
| Compound Name | methyl 2-[3-(2,2-dimethylpropanethioylamino)-4-fluorophenyl]acetate |
|---|---|
| PubChem CID | 18613626 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | methyl 2-[3-(2,2-dimethylpropanethioylamino)-4-fluorophenyl]acetate |
| SMILES | COC(=O)Cc1ccc(F)c(NC(=S)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H18FNO2S/c1-14(2,3)13(19)16-11-7-9(5-6-10(11)15)8-12(17)18-4/h5-7H,8H2,1-4H3,(H,16,19) |
| InChIKey | XHNBBQFJCRAKRO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|