C21H34OSi — CID 18622686
4,4-di(cyclopenta-1,3-dien-1-yl)pentoxy-triethylsilane (PubChem CID 18622686) has the molecular formula C21H34OSi and a molecular weight of 330.59 g/mol. Its IUPAC name is 4,4-di(cyclopenta-1,3-dien-1-yl)pentoxy-triethylsilane.
| Compound Name | 4,4-di(cyclopenta-1,3-dien-1-yl)pentoxy-triethylsilane |
|---|---|
| PubChem CID | 18622686 |
| Molecular Formula | C21H34OSi |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 4,4-di(cyclopenta-1,3-dien-1-yl)pentoxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCCCC(C)(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C21H34OSi/c1-5-23(6-2,7-3)22-18-12-17-21(4,19-13-8-9-14-19)20-15-10-11-16-20/h8-11,13,15H,5-7,12,14,16-18H2,1-4H3 |
| InChIKey | CWAZBULWSYTAAX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|