C18H18ClNOSi — CID 18630380
CID 18630380 (PubChem CID 18630380) has the molecular formula C18H18ClNOSi and a molecular weight of 327.89 g/mol.
| Compound Name | CID 18630380 |
|---|---|
| PubChem CID | 18630380 |
| Molecular Formula | C18H18ClNOSi |
| Molecular Weight | 327.89 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | — |
| SMILES | C=CCc1ccccc1[Si]c1cccc(Cl)c1C(=O)NCC |
| InChI | InChI=1S/C18H18ClNOSi/c1-3-8-13-9-5-6-11-15(13)22-16-12-7-10-14(19)17(16)18(21)20-4-2/h3,5-7,9-12H,1,4,8H2,2H3,(H,20,21) |
| InChIKey | OGIIHQMVJJKKEQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.89 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|