C15H31NO4S — CID 18632652
(2R,3R,4S)-4-amino-6-cyclohexyl-1-propan-2-ylsulfonylhexane-2,3-diol (PubChem CID 18632652) has the molecular formula C15H31NO4S and a molecular weight of 321.48 g/mol. Its IUPAC name is (2R,3R,4S)-4-amino-6-cyclohexyl-1-propan-2-ylsulfonylhexane-2,3-diol.
| Compound Name | (2R,3R,4S)-4-amino-6-cyclohexyl-1-propan-2-ylsulfonylhexane-2,3-diol |
|---|---|
| PubChem CID | 18632652 |
| Molecular Formula | C15H31NO4S |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | (2R,3R,4S)-4-amino-6-cyclohexyl-1-propan-2-ylsulfonylhexane-2,3-diol |
| SMILES | CC(C)S(=O)(=O)C[C@H](O)[C@H](O)[C@@H](N)CCC1CCCCC1 |
| InChI | InChI=1S/C15H31NO4S/c1-11(2)21(19,20)10-14(17)15(18)13(16)9-8-12-6-4-3-5-7-12/h11-15,17-18H,3-10,16H2,1-2H3/t13-,14-,15+/m0/s1 |
| InChIKey | RMBCIMCUJBSBFX-SOUVJXGZSA-N |
| XLogP | 1.22 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |