C18H30Cl2 — CID 18633778
14,14-dichloro-3-methyl-11-propyldispiro[5.1.58.16]tetradecane (PubChem CID 18633778) has the molecular formula C18H30Cl2 and a molecular weight of 317.34 g/mol. Its IUPAC name is 14,14-dichloro-3-methyl-11-propyldispiro[5.1.58.16]tetradecane.
| Compound Name | 14,14-dichloro-3-methyl-11-propyldispiro[5.1.58.16]tetradecane |
|---|---|
| PubChem CID | 18633778 |
| Molecular Formula | C18H30Cl2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 14,14-dichloro-3-methyl-11-propyldispiro[5.1.58.16]tetradecane |
| SMILES | CCCC1CCC2(CC1)CC1(CCC(C)CC1)C2(Cl)Cl |
| InChI | InChI=1S/C18H30Cl2/c1-3-4-15-7-11-17(12-8-15)13-16(18(17,19)20)9-5-14(2)6-10-16/h14-15H,3-13H2,1-2H3 |
| InChIKey | CDLFPPHVMIKRCS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|