C26H38O3 — CID 18634547
4-[(1S,8R,9S,10R,17R)-1,10,17-trimethyl-3-oxo-1,2,6,7,8,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]butyl acetate (PubChem CID 18634547) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is 4-[(1S,8R,9S,10R,17R)-1,10,17-trimethyl-3-oxo-1,2,6,7,8,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]butyl acetate.
| Compound Name | 4-[(1S,8R,9S,10R,17R)-1,10,17-trimethyl-3-oxo-1,2,6,7,8,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]butyl acetate |
|---|---|
| PubChem CID | 18634547 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 4-[(1S,8R,9S,10R,17R)-1,10,17-trimethyl-3-oxo-1,2,6,7,8,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]butyl acetate |
| SMILES | CC(=O)OCCCC[C@]1(C)CCC2=C1CC[C@H]1[C@H]2CCC2=CC(=O)C[C@H](C)[C@@]21C |
| InChI | InChI=1S/C26H38O3/c1-17-15-20(28)16-19-7-8-21-22-11-13-25(3,12-5-6-14-29-18(2)27)23(22)9-10-24(21)26(17,19)4/h16-17,21,24H,5-15H2,1-4H3/t17-,21-,24-,25+,26-/m0/s1 |
| InChIKey | RBZIBILWMVRGLZ-LVYUVYJESA-N |
| XLogP | 6.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|