C18H18Br2O5 — CID 18634634
methyl (4R)-2-(1-bromoethyl)-2-(5-bromo-6-methoxynaphthalen-2-yl)-1,3-dioxolane-4-carboxylate (PubChem CID 18634634) has the molecular formula C18H18Br2O5 and a molecular weight of 474.15 g/mol. Its IUPAC name is methyl (4R)-2-(1-bromoethyl)-2-(5-bromo-6-methoxynaphthalen-2-yl)-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4R)-2-(1-bromoethyl)-2-(5-bromo-6-methoxynaphthalen-2-yl)-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 18634634 |
| Molecular Formula | C18H18Br2O5 |
| Molecular Weight | 474.15 g/mol |
| Exact Mass | 471.95 |
| IUPAC Name | methyl (4R)-2-(1-bromoethyl)-2-(5-bromo-6-methoxynaphthalen-2-yl)-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)[C@H]1COC(c2ccc3c(Br)c(OC)ccc3c2)(C(C)Br)O1 |
| InChI | InChI=1S/C18H18Br2O5/c1-10(19)18(24-9-15(25-18)17(21)23-3)12-5-6-13-11(8-12)4-7-14(22-2)16(13)20/h4-8,10,15H,9H2,1-3H3/t10?,15-,18?/m1/s1 |
| InChIKey | XIVPZHKLFNUHFI-VTONZJQESA-N |
| XLogP | 4.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.15 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|