C16H17BrO3 — CID 18602098
2-[(1S)-1-bromoethyl]-2-(6-methoxynaphthalen-2-yl)-1,3-dioxolane (PubChem CID 18602098) has the molecular formula C16H17BrO3 and a molecular weight of 337.21 g/mol. Its IUPAC name is 2-[(1S)-1-bromoethyl]-2-(6-methoxynaphthalen-2-yl)-1,3-dioxolane.
| Compound Name | 2-[(1S)-1-bromoethyl]-2-(6-methoxynaphthalen-2-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 18602098 |
| Molecular Formula | C16H17BrO3 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-[(1S)-1-bromoethyl]-2-(6-methoxynaphthalen-2-yl)-1,3-dioxolane |
| SMILES | COc1ccc2cc(C3([C@H](C)Br)OCCO3)ccc2c1 |
| InChI | InChI=1S/C16H17BrO3/c1-11(17)16(19-7-8-20-16)14-5-3-13-10-15(18-2)6-4-12(13)9-14/h3-6,9-11H,7-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | BZUYCVPBTJTLJT-NSHDSACASA-N |
| XLogP | 3.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|