C19H23BrO3 — CID 54472939
2-[(1S)-1-bromoethyl]-2-(6-methoxynaphthalen-2-yl)-5,5-dimethyl-1,3-dioxane (PubChem CID 54472939) has the molecular formula C19H23BrO3 and a molecular weight of 379.29 g/mol. Its IUPAC name is 2-[(1S)-1-bromoethyl]-2-(6-methoxynaphthalen-2-yl)-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-[(1S)-1-bromoethyl]-2-(6-methoxynaphthalen-2-yl)-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 54472939 |
| Molecular Formula | C19H23BrO3 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[(1S)-1-bromoethyl]-2-(6-methoxynaphthalen-2-yl)-5,5-dimethyl-1,3-dioxane |
| SMILES | COc1ccc2cc(C3([C@H](C)Br)OCC(C)(C)CO3)ccc2c1 |
| InChI | InChI=1S/C19H23BrO3/c1-13(20)19(22-11-18(2,3)12-23-19)16-7-5-15-10-17(21-4)8-6-14(15)9-16/h5-10,13H,11-12H2,1-4H3/t13-/m0/s1 |
| InChIKey | XJONHDZHTLGQLO-ZDUSSCGKSA-N |
| XLogP | 4.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|