C25H26O6S — CID 88672514
1-[2-(6-methoxynaphthalen-2-yl)-4,7-dihydro-1,3-dioxepin-2-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 88672514) has the molecular formula C25H26O6S and a molecular weight of 454.54 g/mol. Its IUPAC name is 1-[2-(6-methoxynaphthalen-2-yl)-4,7-dihydro-1,3-dioxepin-2-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 1-[2-(6-methoxynaphthalen-2-yl)-4,7-dihydro-1,3-dioxepin-2-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88672514 |
| Molecular Formula | C25H26O6S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 1-[2-(6-methoxynaphthalen-2-yl)-4,7-dihydro-1,3-dioxepin-2-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | COc1ccc2cc(C3(C(C)OS(=O)(=O)c4ccc(C)cc4)OCC=CCO3)ccc2c1 |
| InChI | InChI=1S/C25H26O6S/c1-18-6-12-24(13-7-18)32(26,27)31-19(2)25(29-14-4-5-15-30-25)22-10-8-21-17-23(28-3)11-9-20(21)16-22/h4-13,16-17,19H,14-15H2,1-3H3 |
| InChIKey | XMTQIARYVUMJLT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|