C28H30ClN5O5 — CID 18635236
4-(aminomethyl)-N-[3-[3-(3-chloro-2-nitrophenoxy)phenyl]-1-oxo-1-(pyridin-4-ylamino)propan-2-yl]cyclohexane-1-carboxamide (PubChem CID 18635236) has the molecular formula C28H30ClN5O5 and a molecular weight of 552.03 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-[3-(3-chloro-2-nitrophenoxy)phenyl]-1-oxo-1-(pyridin-4-ylamino)propan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[3-[3-(3-chloro-2-nitrophenoxy)phenyl]-1-oxo-1-(pyridin-4-ylamino)propan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 18635236 |
| Molecular Formula | C28H30ClN5O5 |
| Molecular Weight | 552.03 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 4-(aminomethyl)-N-[3-[3-(3-chloro-2-nitrophenoxy)phenyl]-1-oxo-1-(pyridin-4-ylamino)propan-2-yl]cyclohexane-1-carboxamide |
| SMILES | NCC1CCC(C(=O)NC(Cc2cccc(Oc3cccc(Cl)c3[N+](=O)[O-])c2)C(=O)Nc2ccncc2)CC1 |
| InChI | InChI=1S/C28H30ClN5O5/c29-23-5-2-6-25(26(23)34(37)38)39-22-4-1-3-19(15-22)16-24(28(36)32-21-11-13-31-14-12-21)33-27(35)20-9-7-18(17-30)8-10-20/h1-6,11-15,18,20,24H,7-10,16-17,30H2,(H,33,35)(H,31,32,36) |
| InChIKey | AUQWBTYXVOIWCT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.03 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|