C33H41N9O3 — CID 123778978
4-(aminomethyl)-N-[3-[3-[6-[3-(methylamino)propoxy]-3-pyridinyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide (PubChem CID 123778978) has the molecular formula C33H41N9O3 and a molecular weight of 611.75 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-[3-[6-[3-(methylamino)propoxy]-3-pyridinyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[3-[3-[6-[3-(methylamino)propoxy]-3-pyridinyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 123778978 |
| Molecular Formula | C33H41N9O3 |
| Molecular Weight | 611.75 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | 4-(aminomethyl)-N-[3-[3-[6-[3-(methylamino)propoxy]-3-pyridinyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide |
| SMILES | CNCCCOc1ccc(-c2cccc(CC(NC(=O)C3CCC(CN)CC3)C(=O)Nc3ccc(-c4nn[nH]n4)cc3)c2)cn1 |
| InChI | InChI=1S/C33H41N9O3/c1-35-16-3-17-45-30-15-12-27(21-36-30)26-5-2-4-23(18-26)19-29(38-32(43)25-8-6-22(20-34)7-9-25)33(44)37-28-13-10-24(11-14-28)31-39-41-42-40-31/h2,4-5,10-15,18,21-22,25,29,35H,3,6-9,16-17,19-20,34H2,1H3,(H,37,44)(H,38,43)(H,39,40,41,42) |
| InChIKey | RVAXCTANRMIVDE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 172.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|