C27H33N3O4 — CID 18636211
(8aR,12aR,13aR)-3,4-dimethoxy-8-oxo-N-(2-phenylethyl)-6,8a,9,10,11,12a,13,13a-octahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide (PubChem CID 18636211) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is (8aR,12aR,13aR)-3,4-dimethoxy-8-oxo-N-(2-phenylethyl)-6,8a,9,10,11,12a,13,13a-octahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide.
| Compound Name | (8aR,12aR,13aR)-3,4-dimethoxy-8-oxo-N-(2-phenylethyl)-6,8a,9,10,11,12a,13,13a-octahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide |
|---|---|
| PubChem CID | 18636211 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (8aR,12aR,13aR)-3,4-dimethoxy-8-oxo-N-(2-phenylethyl)-6,8a,9,10,11,12a,13,13a-octahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide |
| SMILES | COc1ccc2c(c1OC)CCN1C(=O)[C@@H]3CCCN(C(=O)NCCc4ccccc4)[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C27H33N3O4/c1-33-24-11-10-19-20(25(24)34-2)13-16-29-22(19)17-23-21(26(29)31)9-6-15-30(23)27(32)28-14-12-18-7-4-3-5-8-18/h3-5,7-8,10-11,21-23H,6,9,12-17H2,1-2H3,(H,28,32)/t21-,22-,23-/m1/s1 |
| InChIKey | OQQDJRRCHONSLJ-DNVJHFABSA-N |
| XLogP | 3.57 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |