C20H38N4O5 — CID 18637550
(2R)-2-[(1S)-8-amino-1-carboxyoctyl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18637550) has the molecular formula C20H38N4O5 and a molecular weight of 414.55 g/mol. Its IUPAC name is (2R)-2-[(1S)-8-amino-1-carboxyoctyl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-2-[(1S)-8-amino-1-carboxyoctyl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18637550 |
| Molecular Formula | C20H38N4O5 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | (2R)-2-[(1S)-8-amino-1-carboxyoctyl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCCCCC[C@H](C(=O)O)[C@@]1(C(=O)O)CCCN1C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C20H38N4O5/c21-12-6-3-1-2-4-9-15(18(26)27)20(19(28)29)11-8-14-24(20)17(25)16(23)10-5-7-13-22/h15-16H,1-14,21-23H2,(H,26,27)(H,28,29)/t15-,16+,20-/m1/s1 |
| InChIKey | RCOMPPBMZZCPRQ-GQIGUUNPSA-N |
| XLogP | 0.89 |
| TPSA | 172.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|