About [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate
[4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate (PubChem CID 18639889) has the molecular formula C23H34Cl2N2O4
and a molecular weight of 473.44 g/mol. Its IUPAC name is [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate.
Molecular Properties
| Compound Name | [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate |
| PubChem CID | 18639889 |
| Molecular Formula | C23H34Cl2N2O4 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1c(Cl)cc(Cl)c(OC)c1C(=O)NC[C@@H]1CCCN1CC |
| InChI | InChI=1S/C23H34Cl2N2O4/c1-5-8-10-15(6-2)23(29)31-21-18(25)13-17(24)20(30-4)19(21)22(28)26-14-16-11-9-12-27(16)7-3/h13,15-16H,5-12,14H2,1-4H3,(H,26,28)/t15?,16-/m0/s1 |
| InChIKey | NZHZWQNIKOUGLG-LYKKTTPLSA-N |
| XLogP | 5.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate?
The IUPAC name of [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate (CID 18639889) is [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate.
What is the SMILES notation for [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate?
The canonical SMILES for [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate is CCCCC(CC)C(=O)Oc1c(Cl)cc(Cl)c(OC)c1C(=O)NC[C@@H]1CCCN1CC.
What is the InChIKey of [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate?
The InChIKey is NZHZWQNIKOUGLG-LYKKTTPLSA-N. The full InChI is InChI=1S/C23H34Cl2N2O4/c1-5-8-10-15(6-2)23(29)31-21-18(25)13-17(24)20(30-4)19(21)22(28)26-14-16-11-9-12-27(16)7-3/h13,15-16H,5-12,14H2,1-4H3,(H,26,28)/t15?,16-/m0/s1.
What are the key properties of [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate?
[4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate has a molecular weight of 473.44 g/mol, XLogP of 5.34, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4,6-dichloro-2-[[(2S)-1-ethylpyrrolidin-2-yl]methylcarbamoyl]-3-methoxyphenyl] 2-ethylhexanoate is sourced from PubChem (CID 18639889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).