C21H27BrO2 — CID 18642037
(8R,9S,10R,13S,14S)-2-bromo-4,10,13-trimethyl-7-methylidene-1,2,6,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 18642037) has the molecular formula C21H27BrO2 and a molecular weight of 391.35 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-2-bromo-4,10,13-trimethyl-7-methylidene-1,2,6,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-2-bromo-4,10,13-trimethyl-7-methylidene-1,2,6,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 18642037 |
| Molecular Formula | C21H27BrO2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (8R,9S,10R,13S,14S)-2-bromo-4,10,13-trimethyl-7-methylidene-1,2,6,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=C1CC2=C(C)C(=O)C(Br)C[C@]2(C)[C@H]2CC[C@]3(C)C(=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C21H27BrO2/c1-11-9-15-12(2)19(24)16(22)10-21(15,4)14-7-8-20(3)13(18(11)14)5-6-17(20)23/h13-14,16,18H,1,5-10H2,2-4H3/t13-,14-,16?,18-,20-,21+/m0/s1 |
| InChIKey | DICOJULAHOFIGY-FLJXWYRWSA-N |
| XLogP | 5.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|