C27H41NO2 — CID 24764811
(3R,5S,8R,9S,10R,13S,14S)-5-hydroxy-10,13-dimethyl-7-methylidene-3-[(Z)-2-piperidin-4-ylethenyl]-1,2,3,4,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 24764811) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is (3R,5S,8R,9S,10R,13S,14S)-5-hydroxy-10,13-dimethyl-7-methylidene-3-[(Z)-2-piperidin-4-ylethenyl]-1,2,3,4,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,5S,8R,9S,10R,13S,14S)-5-hydroxy-10,13-dimethyl-7-methylidene-3-[(Z)-2-piperidin-4-ylethenyl]-1,2,3,4,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 24764811 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | (3R,5S,8R,9S,10R,13S,14S)-5-hydroxy-10,13-dimethyl-7-methylidene-3-[(Z)-2-piperidin-4-ylethenyl]-1,2,3,4,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C=C1C[C@@]2(O)C[C@H](/C=C\C3CCNCC3)CC[C@]2(C)[C@H]2CC[C@]3(C)C(=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C27H41NO2/c1-18-16-27(30)17-20(5-4-19-10-14-28-15-11-19)8-13-26(27,3)22-9-12-25(2)21(24(18)22)6-7-23(25)29/h4-5,19-22,24,28,30H,1,6-17H2,2-3H3/b5-4-/t20-,21+,22+,24+,25+,26-,27-/m1/s1 |
| InChIKey | JXSUNUADZXACHB-ABKUXWKSSA-N |
| XLogP | 5.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|