C29H35FNO6+ — CID 18645625
[2-[(10S,11S,13S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 1-methylpyridin-1-ium-3-carboxylate (PubChem CID 18645625) has the molecular formula C29H35FNO6+ and a molecular weight of 512.60 g/mol. Its IUPAC name is [2-[(10S,11S,13S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 1-methylpyridin-1-ium-3-carboxylate.
| Compound Name | [2-[(10S,11S,13S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 1-methylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 18645625 |
| Molecular Formula | C29H35FNO6+ |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | [2-[(10S,11S,13S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 1-methylpyridin-1-ium-3-carboxylate |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=C[C@]4(C)C3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)COC(=O)c1ccc[n+](C)c1 |
| InChI | InChI=1S/C29H35FNO6/c1-17-12-22-21-8-7-19-13-20(32)9-10-26(19,2)28(21,30)23(33)14-27(22,3)29(17,36)24(34)16-37-25(35)18-6-5-11-31(4)15-18/h5-6,9-11,13,15,17,21-23,33,36H,7-8,12,14,16H2,1-4H3/q+1/t17-,21?,22?,23+,26+,27+,28?,29+/m1/s1 |
| InChIKey | DSMWNNILNMIQCS-QICIGVFPSA-N |
| XLogP | 2.58 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|