C30H34ClFO6 — CID 68908928
[2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-(chloromethyl)benzoate (PubChem CID 68908928) has the molecular formula C30H34ClFO6 and a molecular weight of 545.05 g/mol. Its IUPAC name is [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-(chloromethyl)benzoate.
| Compound Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-(chloromethyl)benzoate |
|---|---|
| PubChem CID | 68908928 |
| Molecular Formula | C30H34ClFO6 |
| Molecular Weight | 545.05 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-(chloromethyl)benzoate |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)COC(=O)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C30H34ClFO6/c1-17-12-23-22-9-8-20-13-21(33)10-11-27(20,2)29(22,32)24(34)14-28(23,3)30(17,37)25(35)16-38-26(36)19-6-4-18(15-31)5-7-19/h4-7,10-11,13,17,22-24,34,37H,8-9,12,14-16H2,1-3H3/t17-,22+,23+,24+,27+,28+,29+,30+/m1/s1 |
| InChIKey | VRGXERNUZQQKRO-WWTIVVFGSA-N |
| XLogP | 4.50 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.05 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|