C7H7N3O — CID 18645755
2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one (PubChem CID 18645755) has the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. Its IUPAC name is 2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one.
| Compound Name | 2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 18645755 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 2,4-dihydro-1H-pyrido[3,4-b]pyrazin-3-one |
| SMILES | O=C1CNc2ccncc2N1 |
| InChI | InChI=1S/C7H7N3O/c11-7-4-9-5-1-2-8-3-6(5)10-7/h1-3,9H,4H2,(H,10,11) |
| InChIKey | MJNNGMNZUQSJNV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |