C19H22N2O2S2 — CID 18645817
[(2S)-4-sulfanylidene-2-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]-(1,2,3,4-tetrahydronaphthalen-2-yl)methanone (PubChem CID 18645817) has the molecular formula C19H22N2O2S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is [(2S)-4-sulfanylidene-2-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]-(1,2,3,4-tetrahydronaphthalen-2-yl)methanone.
| Compound Name | [(2S)-4-sulfanylidene-2-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]-(1,2,3,4-tetrahydronaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 18645817 |
| Molecular Formula | C19H22N2O2S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [(2S)-4-sulfanylidene-2-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]-(1,2,3,4-tetrahydronaphthalen-2-yl)methanone |
| SMILES | O=C(C1CCc2ccccc2C1)C1C(=S)CN[C@@H]1C(=O)N1CCSC1 |
| InChI | InChI=1S/C19H22N2O2S2/c22-18(14-6-5-12-3-1-2-4-13(12)9-14)16-15(24)10-20-17(16)19(23)21-7-8-25-11-21/h1-4,14,16-17,20H,5-11H2/t14?,16?,17-/m0/s1 |
| InChIKey | JFGIAHXOWOPIDF-PREGVCBESA-N |
| XLogP | 1.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|