C27H33F2N5O2 — CID 18646498
1-[4-[[(2S,4S)-4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methoxy]phenyl]-4-propan-2-ylpiperazine (PubChem CID 18646498) has the molecular formula C27H33F2N5O2 and a molecular weight of 497.59 g/mol. Its IUPAC name is 1-[4-[[(2S,4S)-4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methoxy]phenyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[4-[[(2S,4S)-4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methoxy]phenyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 18646498 |
| Molecular Formula | C27H33F2N5O2 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 1-[4-[[(2S,4S)-4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methoxy]phenyl]-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(c2ccc(OC[C@@H]3C[C@@](Cn4cncn4)(c4ccc(F)cc4F)CO3)cc2)CC1 |
| InChI | InChI=1S/C27H33F2N5O2/c1-20(2)32-9-11-33(12-10-32)22-4-6-23(7-5-22)35-15-24-14-27(17-36-24,16-34-19-30-18-31-34)25-8-3-21(28)13-26(25)29/h3-8,13,18-20,24H,9-12,14-17H2,1-2H3/t24-,27-/m0/s1 |
| InChIKey | YQWQRWLVEMXPNO-IGKIAQTJSA-N |
| XLogP | 3.89 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|