C20H32O6 — CID 18647593
[(2R)-1-(6,6-dimethoxyhexoxy)-3-phenylmethoxypropan-2-yl] acetate (PubChem CID 18647593) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is [(2R)-1-(6,6-dimethoxyhexoxy)-3-phenylmethoxypropan-2-yl] acetate.
| Compound Name | [(2R)-1-(6,6-dimethoxyhexoxy)-3-phenylmethoxypropan-2-yl] acetate |
|---|---|
| PubChem CID | 18647593 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | [(2R)-1-(6,6-dimethoxyhexoxy)-3-phenylmethoxypropan-2-yl] acetate |
| SMILES | COC(CCCCCOC[C@H](COCc1ccccc1)OC(C)=O)OC |
| InChI | InChI=1S/C20H32O6/c1-17(21)26-19(16-25-14-18-10-6-4-7-11-18)15-24-13-9-5-8-12-20(22-2)23-3/h4,6-7,10-11,19-20H,5,8-9,12-16H2,1-3H3/t19-/m1/s1 |
| InChIKey | SADBIMXHGFFMPI-LJQANCHMSA-N |
| XLogP | 3.33 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|