C14H11F15O2 — CID 18650021
4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)cyclohexane-1-carboxylic acid (PubChem CID 18650021) has the molecular formula C14H11F15O2 and a molecular weight of 496.21 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 18650021 |
| Molecular Formula | C14H11F15O2 |
| Molecular Weight | 496.21 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H11F15O2/c15-8(16,6-3-1-5(2-4-6)7(30)31)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)29/h5-6H,1-4H2,(H,30,31) |
| InChIKey | RSWLJPUDHSYLBQ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.21 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|