C10H11F7O2 — CID 57134313
4-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexane-1-carboxylic acid (PubChem CID 57134313) has the molecular formula C10H11F7O2 and a molecular weight of 296.18 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57134313 |
| Molecular Formula | C10H11F7O2 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H11F7O2/c11-8(12,9(13,14)10(15,16)17)6-3-1-5(2-4-6)7(18)19/h5-6H,1-4H2,(H,18,19) |
| InChIKey | XHYURWMFYFFMBL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|