C37H39N3 — CID 18652844
(2aS,4R)-4-(dipropylamino)-1-trityl-2a,3,4,5-tetrahydro-2H-benzo[cd]indole-6-carbonitrile (PubChem CID 18652844) has the molecular formula C37H39N3 and a molecular weight of 525.74 g/mol. Its IUPAC name is (2aS,4R)-4-(dipropylamino)-1-trityl-2a,3,4,5-tetrahydro-2H-benzo[cd]indole-6-carbonitrile.
| Compound Name | (2aS,4R)-4-(dipropylamino)-1-trityl-2a,3,4,5-tetrahydro-2H-benzo[cd]indole-6-carbonitrile |
|---|---|
| PubChem CID | 18652844 |
| Molecular Formula | C37H39N3 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | (2aS,4R)-4-(dipropylamino)-1-trityl-2a,3,4,5-tetrahydro-2H-benzo[cd]indole-6-carbonitrile |
| SMILES | CCCN(CCC)[C@H]1Cc2c(C#N)ccc3c2[C@H](C1)CN3C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H39N3/c1-3-22-39(23-4-2)33-24-29-27-40(35-21-20-28(26-38)34(25-33)36(29)35)37(30-14-8-5-9-15-30,31-16-10-6-11-17-31)32-18-12-7-13-19-32/h5-21,29,33H,3-4,22-25,27H2,1-2H3/t29-,33-/m1/s1 |
| InChIKey | IJBDSQFODMUBEW-CYTLCNBWSA-N |
| XLogP | 7.89 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|