C27H43N3Si — CID 19096255
4-(dipropylamino)-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indole-6-carbonitrile (PubChem CID 19096255) has the molecular formula C27H43N3Si and a molecular weight of 437.75 g/mol. Its IUPAC name is 4-(dipropylamino)-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indole-6-carbonitrile.
| Compound Name | 4-(dipropylamino)-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indole-6-carbonitrile |
|---|---|
| PubChem CID | 19096255 |
| Molecular Formula | C27H43N3Si |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 437.32 |
| IUPAC Name | 4-(dipropylamino)-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indole-6-carbonitrile |
| SMILES | CCCN(CCC)C1Cc2cn([Si](C(C)C)(C(C)C)C(C)C)c3ccc(C#N)c(c23)C1 |
| InChI | InChI=1S/C27H43N3Si/c1-9-13-29(14-10-2)24-15-23-18-30(31(19(3)4,20(5)6)21(7)8)26-12-11-22(17-28)25(16-24)27(23)26/h11-12,18-21,24H,9-10,13-16H2,1-8H3 |
| InChIKey | WAPSHNVXAKRBFD-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|